C24H24N4O4S — CID 22552071
N-(2-ethoxyphenyl)-2-[methyl-[(2-phenyl-3H-benzimidazol-5-yl)sulfonyl]amino]acetamide (PubChem CID 22552071) has the molecular formula C24H24N4O4S and a molecular weight of 464.55 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-2-[methyl-[(2-phenyl-3H-benzimidazol-5-yl)sulfonyl]amino]acetamide.
| Compound Name | N-(2-ethoxyphenyl)-2-[methyl-[(2-phenyl-3H-benzimidazol-5-yl)sulfonyl]amino]acetamide |
|---|---|
| PubChem CID | 22552071 |
| Molecular Formula | C24H24N4O4S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | N-(2-ethoxyphenyl)-2-[methyl-[(2-phenyl-3H-benzimidazol-5-yl)sulfonyl]amino]acetamide |
| SMILES | CCOc1ccccc1NC(=O)CN(C)S(=O)(=O)c1ccc2nc(-c3ccccc3)[nH]c2c1 |
| InChI | InChI=1S/C24H24N4O4S/c1-3-32-22-12-8-7-11-20(22)25-23(29)16-28(2)33(30,31)18-13-14-19-21(15-18)27-24(26-19)17-9-5-4-6-10-17/h4-15H,3,16H2,1-2H3,(H,25,29)(H,26,27) |
| InChIKey | DJBQXXKJOAKWHY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |