C26H25N3O4 — CID 23773806
[1-(2-ethoxyanilino)-1-oxopropan-2-yl] 2-(4-methylphenyl)-3H-benzimidazole-5-carboxylate (PubChem CID 23773806) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is [1-(2-ethoxyanilino)-1-oxopropan-2-yl] 2-(4-methylphenyl)-3H-benzimidazole-5-carboxylate.
| Compound Name | [1-(2-ethoxyanilino)-1-oxopropan-2-yl] 2-(4-methylphenyl)-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 23773806 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | [1-(2-ethoxyanilino)-1-oxopropan-2-yl] 2-(4-methylphenyl)-3H-benzimidazole-5-carboxylate |
| SMILES | CCOc1ccccc1NC(=O)C(C)OC(=O)c1ccc2nc(-c3ccc(C)cc3)[nH]c2c1 |
| InChI | InChI=1S/C26H25N3O4/c1-4-32-23-8-6-5-7-21(23)29-25(30)17(3)33-26(31)19-13-14-20-22(15-19)28-24(27-20)18-11-9-16(2)10-12-18/h5-15,17H,4H2,1-3H3,(H,27,28)(H,29,30) |
| InChIKey | COYBCKQGDXMLHZ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |