C30H25N3O3 — CID 23888110
[1-oxo-1-(N-phenylanilino)propan-2-yl] 2-(4-methylphenyl)-3H-benzimidazole-5-carboxylate (PubChem CID 23888110) has the molecular formula C30H25N3O3 and a molecular weight of 475.55 g/mol. Its IUPAC name is [1-oxo-1-(N-phenylanilino)propan-2-yl] 2-(4-methylphenyl)-3H-benzimidazole-5-carboxylate.
| Compound Name | [1-oxo-1-(N-phenylanilino)propan-2-yl] 2-(4-methylphenyl)-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 23888110 |
| Molecular Formula | C30H25N3O3 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | [1-oxo-1-(N-phenylanilino)propan-2-yl] 2-(4-methylphenyl)-3H-benzimidazole-5-carboxylate |
| SMILES | Cc1ccc(-c2nc3ccc(C(=O)OC(C)C(=O)N(c4ccccc4)c4ccccc4)cc3[nH]2)cc1 |
| InChI | InChI=1S/C30H25N3O3/c1-20-13-15-22(16-14-20)28-31-26-18-17-23(19-27(26)32-28)30(35)36-21(2)29(34)33(24-9-5-3-6-10-24)25-11-7-4-8-12-25/h3-19,21H,1-2H3,(H,31,32) |
| InChIKey | OFLPQZGCGHCNJV-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |