C36H27N3O3 — CID 23888111
[1-oxo-1-(N-phenylanilino)propan-2-yl] 2,3-diphenylquinoxaline-6-carboxylate (PubChem CID 23888111) has the molecular formula C36H27N3O3 and a molecular weight of 549.63 g/mol. Its IUPAC name is [1-oxo-1-(N-phenylanilino)propan-2-yl] 2,3-diphenylquinoxaline-6-carboxylate.
| Compound Name | [1-oxo-1-(N-phenylanilino)propan-2-yl] 2,3-diphenylquinoxaline-6-carboxylate |
|---|---|
| PubChem CID | 23888111 |
| Molecular Formula | C36H27N3O3 |
| Molecular Weight | 549.63 g/mol |
| Exact Mass | 549.21 |
| IUPAC Name | [1-oxo-1-(N-phenylanilino)propan-2-yl] 2,3-diphenylquinoxaline-6-carboxylate |
| SMILES | CC(OC(=O)c1ccc2nc(-c3ccccc3)c(-c3ccccc3)nc2c1)C(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H27N3O3/c1-25(35(40)39(29-18-10-4-11-19-29)30-20-12-5-13-21-30)42-36(41)28-22-23-31-32(24-28)38-34(27-16-8-3-9-17-27)33(37-31)26-14-6-2-7-15-26/h2-25H,1H3 |
| InChIKey | GNCNSMTZPNFBOX-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.63 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |