C30H19F4N3O3 — CID 23943878
[1-oxo-1-(2,3,5,6-tetrafluoroanilino)propan-2-yl] 2,3-diphenylquinoxaline-6-carboxylate (PubChem CID 23943878) has the molecular formula C30H19F4N3O3 and a molecular weight of 545.49 g/mol. Its IUPAC name is [1-oxo-1-(2,3,5,6-tetrafluoroanilino)propan-2-yl] 2,3-diphenylquinoxaline-6-carboxylate.
| Compound Name | [1-oxo-1-(2,3,5,6-tetrafluoroanilino)propan-2-yl] 2,3-diphenylquinoxaline-6-carboxylate |
|---|---|
| PubChem CID | 23943878 |
| Molecular Formula | C30H19F4N3O3 |
| Molecular Weight | 545.49 g/mol |
| Exact Mass | 545.14 |
| IUPAC Name | [1-oxo-1-(2,3,5,6-tetrafluoroanilino)propan-2-yl] 2,3-diphenylquinoxaline-6-carboxylate |
| SMILES | CC(OC(=O)c1ccc2nc(-c3ccccc3)c(-c3ccccc3)nc2c1)C(=O)Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C30H19F4N3O3/c1-16(29(38)37-28-24(33)20(31)15-21(32)25(28)34)40-30(39)19-12-13-22-23(14-19)36-27(18-10-6-3-7-11-18)26(35-22)17-8-4-2-5-9-17/h2-16H,1H3,(H,37,38) |
| InChIKey | FHYJQGVYQVXDRF-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.49 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|