C30H29N5O — CID 141334498
4-(dimethylamino)-N-[2-[4-(dimethylamino)phenyl]-3H-benzimidazol-5-yl]-N-phenylbenzamide (PubChem CID 141334498) has the molecular formula C30H29N5O and a molecular weight of 475.60 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[2-[4-(dimethylamino)phenyl]-3H-benzimidazol-5-yl]-N-phenylbenzamide.
| Compound Name | 4-(dimethylamino)-N-[2-[4-(dimethylamino)phenyl]-3H-benzimidazol-5-yl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 141334498 |
| Molecular Formula | C30H29N5O |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | 4-(dimethylamino)-N-[2-[4-(dimethylamino)phenyl]-3H-benzimidazol-5-yl]-N-phenylbenzamide |
| SMILES | CN(C)c1ccc(C(=O)N(c2ccccc2)c2ccc3nc(-c4ccc(N(C)C)cc4)[nH]c3c2)cc1 |
| InChI | InChI=1S/C30H29N5O/c1-33(2)23-14-10-21(11-15-23)29-31-27-19-18-26(20-28(27)32-29)35(25-8-6-5-7-9-25)30(36)22-12-16-24(17-13-22)34(3)4/h5-20H,1-4H3,(H,31,32) |
| InChIKey | QFHYTXYIRUPVCR-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 55.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|