C13H11N3O2 — CID 123138623
N,N-dihydroxy-2-phenyl-3H-benzimidazol-5-amine (PubChem CID 123138623) has the molecular formula C13H11N3O2 and a molecular weight of 241.25 g/mol. Its IUPAC name is N,N-dihydroxy-2-phenyl-3H-benzimidazol-5-amine.
| Compound Name | N,N-dihydroxy-2-phenyl-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 123138623 |
| Molecular Formula | C13H11N3O2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | N,N-dihydroxy-2-phenyl-3H-benzimidazol-5-amine |
| SMILES | ON(O)c1ccc2nc(-c3ccccc3)[nH]c2c1 |
| InChI | InChI=1S/C13H11N3O2/c17-16(18)10-6-7-11-12(8-10)15-13(14-11)9-4-2-1-3-5-9/h1-8,17-18H,(H,14,15) |
| InChIKey | IPAVETKENYCKTQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 72.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|