C18H19N3O2 — CID 122690183
2-(4-tert-butylphenyl)-N-hydroxy-3H-benzimidazole-5-carboxamide (PubChem CID 122690183) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-N-hydroxy-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-(4-tert-butylphenyl)-N-hydroxy-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 122690183 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2-(4-tert-butylphenyl)-N-hydroxy-3H-benzimidazole-5-carboxamide |
| SMILES | CC(C)(C)c1ccc(-c2nc3ccc(C(=O)NO)cc3[nH]2)cc1 |
| InChI | InChI=1S/C18H19N3O2/c1-18(2,3)13-7-4-11(5-8-13)16-19-14-9-6-12(17(22)21-23)10-15(14)20-16/h4-10,23H,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | MKVPVGHBSKZVON-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|