C17H17ClN2 — CID 60646324
2-(4-tert-butylphenyl)-6-chloro-1H-benzimidazole (PubChem CID 60646324) has the molecular formula C17H17ClN2 and a molecular weight of 284.79 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-6-chloro-1H-benzimidazole.
| Compound Name | 2-(4-tert-butylphenyl)-6-chloro-1H-benzimidazole |
|---|---|
| PubChem CID | 60646324 |
| Molecular Formula | C17H17ClN2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 2-(4-tert-butylphenyl)-6-chloro-1H-benzimidazole |
| SMILES | CC(C)(C)c1ccc(-c2nc3ccc(Cl)cc3[nH]2)cc1 |
| InChI | InChI=1S/C17H17ClN2/c1-17(2,3)12-6-4-11(5-7-12)16-19-14-9-8-13(18)10-15(14)20-16/h4-10H,1-3H3,(H,19,20) |
| InChIKey | NKXZAGOKTANLBO-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |