C28H30N4O2S — CID 163984148
6-[(2-tert-butyl-3H-benzimidazol-5-yl)sulfonyl]-2-(4-tert-butylphenyl)-1H-benzimidazole (PubChem CID 163984148) has the molecular formula C28H30N4O2S and a molecular weight of 486.64 g/mol. Its IUPAC name is 6-[(2-tert-butyl-3H-benzimidazol-5-yl)sulfonyl]-2-(4-tert-butylphenyl)-1H-benzimidazole.
| Compound Name | 6-[(2-tert-butyl-3H-benzimidazol-5-yl)sulfonyl]-2-(4-tert-butylphenyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 163984148 |
| Molecular Formula | C28H30N4O2S |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | 6-[(2-tert-butyl-3H-benzimidazol-5-yl)sulfonyl]-2-(4-tert-butylphenyl)-1H-benzimidazole |
| SMILES | CC(C)(C)c1ccc(-c2nc3ccc(S(=O)(=O)c4ccc5nc(C(C)(C)C)[nH]c5c4)cc3[nH]2)cc1 |
| InChI | InChI=1S/C28H30N4O2S/c1-27(2,3)18-9-7-17(8-10-18)25-29-21-13-11-19(15-23(21)30-25)35(33,34)20-12-14-22-24(16-20)32-26(31-22)28(4,5)6/h7-16H,1-6H3,(H,29,30)(H,31,32) |
| InChIKey | TUVCCIJNOWTHLK-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |