C43H46F6N4 — CID 130217038
2-tert-butyl-6-[2-[3-[4-[2-(4-tert-butylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-2,3-dimethylbutan-2-yl]-3H-benzimidazol-5-yl]-1H-benzimidazole (PubChem CID 130217038) has the molecular formula C43H46F6N4 and a molecular weight of 732.86 g/mol. Its IUPAC name is 2-tert-butyl-6-[2-[3-[4-[2-(4-tert-butylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-2,3-dimethylbutan-2-yl]-3H-benzimidazol-5-yl]-1H-benzimidazole.
| Compound Name | 2-tert-butyl-6-[2-[3-[4-[2-(4-tert-butylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-2,3-dimethylbutan-2-yl]-3H-benzimidazol-5-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 130217038 |
| Molecular Formula | C43H46F6N4 |
| Molecular Weight | 732.86 g/mol |
| Exact Mass | 732.36 |
| IUPAC Name | 2-tert-butyl-6-[2-[3-[4-[2-(4-tert-butylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-2,3-dimethylbutan-2-yl]-3H-benzimidazol-5-yl]-1H-benzimidazole |
| SMILES | CC(C)(C)c1ccc(C(c2ccc(C(C)(C)C(C)(C)c3nc4ccc(-c5ccc6nc(C(C)(C)C)[nH]c6c5)cc4[nH]3)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C43H46F6N4/c1-37(2,3)27-13-17-29(18-14-27)41(42(44,45)46,43(47,48)49)30-19-15-28(16-20-30)39(7,8)40(9,10)36-51-32-22-12-26(24-34(32)53-36)25-11-21-31-33(23-25)52-35(50-31)38(4,5)6/h11-24H,1-10H3,(H,50,52)(H,51,53) |
| InChIKey | HCNPFLPOGMHWHD-UHFFFAOYSA-N |
| XLogP | 12.37 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.86 |
| LogP ≤ 5 | 12.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |