About 6-chloro-2-(1,1-difluoroethyl)-1H-benzimidazole
6-chloro-2-(1,1-difluoroethyl)-1H-benzimidazole (PubChem CID 130632057) has the molecular formula C9H7ClF2N2
and a molecular weight of 216.62 g/mol. Its IUPAC name is 6-chloro-2-(1,1-difluoroethyl)-1H-benzimidazole.
Molecular Properties
| Compound Name | 6-chloro-2-(1,1-difluoroethyl)-1H-benzimidazole |
| PubChem CID | 130632057 |
| Molecular Formula | C9H7ClF2N2 |
| Molecular Weight | 216.62 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | 6-chloro-2-(1,1-difluoroethyl)-1H-benzimidazole |
| SMILES | CC(F)(F)c1nc2ccc(Cl)cc2[nH]1 |
| InChI | InChI=1S/C9H7ClF2N2/c1-9(11,12)8-13-6-3-2-5(10)4-7(6)14-8/h2-4H,1H3,(H,13,14) |
| InChIKey | LOCWYJLAFBNDRB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.62 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-chloro-2-(1,1-difluoroethyl)-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-(1,1-difluoroethyl)-1H-benzimidazole?
The IUPAC name of 6-chloro-2-(1,1-difluoroethyl)-1H-benzimidazole (CID 130632057) is 6-chloro-2-(1,1-difluoroethyl)-1H-benzimidazole.
What is the SMILES notation for 6-chloro-2-(1,1-difluoroethyl)-1H-benzimidazole?
The canonical SMILES for 6-chloro-2-(1,1-difluoroethyl)-1H-benzimidazole is CC(F)(F)c1nc2ccc(Cl)cc2[nH]1.
What is the InChIKey of 6-chloro-2-(1,1-difluoroethyl)-1H-benzimidazole?
The InChIKey is LOCWYJLAFBNDRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClF2N2/c1-9(11,12)8-13-6-3-2-5(10)4-7(6)14-8/h2-4H,1H3,(H,13,14).
What are the key properties of 6-chloro-2-(1,1-difluoroethyl)-1H-benzimidazole?
6-chloro-2-(1,1-difluoroethyl)-1H-benzimidazole has a molecular weight of 216.62 g/mol, XLogP of 3.33, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-(1,1-difluoroethyl)-1H-benzimidazole is sourced from PubChem (CID 130632057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).