C25H24N2 — CID 141198504
2-[2-(4-tert-butylphenyl)ethenyl]-6-phenyl-1H-benzimidazole (PubChem CID 141198504) has the molecular formula C25H24N2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 2-[2-(4-tert-butylphenyl)ethenyl]-6-phenyl-1H-benzimidazole.
| Compound Name | 2-[2-(4-tert-butylphenyl)ethenyl]-6-phenyl-1H-benzimidazole |
|---|---|
| PubChem CID | 141198504 |
| Molecular Formula | C25H24N2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 2-[2-(4-tert-butylphenyl)ethenyl]-6-phenyl-1H-benzimidazole |
| SMILES | CC(C)(C)c1ccc(C=Cc2nc3ccc(-c4ccccc4)cc3[nH]2)cc1 |
| InChI | InChI=1S/C25H24N2/c1-25(2,3)21-13-9-18(10-14-21)11-16-24-26-22-15-12-20(17-23(22)27-24)19-7-5-4-6-8-19/h4-17H,1-3H3,(H,26,27) |
| InChIKey | AOQZIFROVRKIAB-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |