About 6-bromo-2-[(E)-2-phenylethenyl]-1H-benzimidazole;ethane
6-bromo-2-[(E)-2-phenylethenyl]-1H-benzimidazole;ethane (PubChem CID 91356602) has the molecular formula C19H23BrN2
and a molecular weight of 359.31 g/mol. Its IUPAC name is 6-bromo-2-[(E)-2-phenylethenyl]-1H-benzimidazole;ethane.
Molecular Properties
| Compound Name | 6-bromo-2-[(E)-2-phenylethenyl]-1H-benzimidazole;ethane |
| PubChem CID | 91356602 |
| Molecular Formula | C19H23BrN2 |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 6-bromo-2-[(E)-2-phenylethenyl]-1H-benzimidazole;ethane |
| SMILES | Brc1ccc2nc(/C=C/c3ccccc3)[nH]c2c1.CC.CC |
| InChI | InChI=1S/C15H11BrN2.2C2H6/c16-12-7-8-13-14(10-12)18-15(17-13)9-6-11-4-2-1-3-5-11;2*1-2/h1-10H,(H,17,18);2*1-2H3/b9-6+;; |
| InChIKey | GINGDXDEQFXLFI-SWSRPJROSA-N |
| XLogP | 6.55 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-bromo-2-[(E)-2-phenylethenyl]-1H-benzimidazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-[(E)-2-phenylethenyl]-1H-benzimidazole;ethane?
The IUPAC name of 6-bromo-2-[(E)-2-phenylethenyl]-1H-benzimidazole;ethane (CID 91356602) is 6-bromo-2-[(E)-2-phenylethenyl]-1H-benzimidazole;ethane.
What is the SMILES notation for 6-bromo-2-[(E)-2-phenylethenyl]-1H-benzimidazole;ethane?
The canonical SMILES for 6-bromo-2-[(E)-2-phenylethenyl]-1H-benzimidazole;ethane is Brc1ccc2nc(/C=C/c3ccccc3)[nH]c2c1.CC.CC.
What is the InChIKey of 6-bromo-2-[(E)-2-phenylethenyl]-1H-benzimidazole;ethane?
The InChIKey is GINGDXDEQFXLFI-SWSRPJROSA-N. The full InChI is InChI=1S/C15H11BrN2.2C2H6/c16-12-7-8-13-14(10-12)18-15(17-13)9-6-11-4-2-1-3-5-11;2*1-2/h1-10H,(H,17,18);2*1-2H3/b9-6+;;.
What are the key properties of 6-bromo-2-[(E)-2-phenylethenyl]-1H-benzimidazole;ethane?
6-bromo-2-[(E)-2-phenylethenyl]-1H-benzimidazole;ethane has a molecular weight of 359.31 g/mol, XLogP of 6.55, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-[(E)-2-phenylethenyl]-1H-benzimidazole;ethane is sourced from PubChem (CID 91356602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).