C27H26N2O — CID 67164172
1-[2-[2-[2-(4-tert-butylphenyl)ethenyl]-3H-benzimidazol-5-yl]phenyl]ethanone (PubChem CID 67164172) has the molecular formula C27H26N2O and a molecular weight of 394.52 g/mol. Its IUPAC name is 1-[2-[2-[2-(4-tert-butylphenyl)ethenyl]-3H-benzimidazol-5-yl]phenyl]ethanone.
| Compound Name | 1-[2-[2-[2-(4-tert-butylphenyl)ethenyl]-3H-benzimidazol-5-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 67164172 |
| Molecular Formula | C27H26N2O |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 1-[2-[2-[2-(4-tert-butylphenyl)ethenyl]-3H-benzimidazol-5-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccccc1-c1ccc2nc(C=Cc3ccc(C(C)(C)C)cc3)[nH]c2c1 |
| InChI | InChI=1S/C27H26N2O/c1-18(30)22-7-5-6-8-23(22)20-12-15-24-25(17-20)29-26(28-24)16-11-19-9-13-21(14-10-19)27(2,3)4/h5-17H,1-4H3,(H,28,29) |
| InChIKey | CWVYHHGFLJFAPN-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |