C26H22F4N2 — CID 67164771
2-[2-(4-tert-butylphenyl)ethenyl]-5-(2-fluorophenyl)-6-(trifluoromethyl)-1H-benzimidazole (PubChem CID 67164771) has the molecular formula C26H22F4N2 and a molecular weight of 438.47 g/mol. Its IUPAC name is 2-[2-(4-tert-butylphenyl)ethenyl]-5-(2-fluorophenyl)-6-(trifluoromethyl)-1H-benzimidazole.
| Compound Name | 2-[2-(4-tert-butylphenyl)ethenyl]-5-(2-fluorophenyl)-6-(trifluoromethyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 67164771 |
| Molecular Formula | C26H22F4N2 |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 2-[2-(4-tert-butylphenyl)ethenyl]-5-(2-fluorophenyl)-6-(trifluoromethyl)-1H-benzimidazole |
| SMILES | CC(C)(C)c1ccc(C=Cc2nc3cc(-c4ccccc4F)c(C(F)(F)F)cc3[nH]2)cc1 |
| InChI | InChI=1S/C26H22F4N2/c1-25(2,3)17-11-8-16(9-12-17)10-13-24-31-22-14-19(18-6-4-5-7-21(18)27)20(26(28,29)30)15-23(22)32-24/h4-15H,1-3H3,(H,31,32) |
| InChIKey | CZOWDOFBHPESCN-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |