C14H10Cl2N2O2S — CID 62067790
2-(3,4-dichlorophenyl)-6-methylsulfonyl-1H-benzimidazole (PubChem CID 62067790) has the molecular formula C14H10Cl2N2O2S and a molecular weight of 341.22 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-6-methylsulfonyl-1H-benzimidazole.
| Compound Name | 2-(3,4-dichlorophenyl)-6-methylsulfonyl-1H-benzimidazole |
|---|---|
| PubChem CID | 62067790 |
| Molecular Formula | C14H10Cl2N2O2S |
| Molecular Weight | 341.22 g/mol |
| Exact Mass | 339.98 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-6-methylsulfonyl-1H-benzimidazole |
| SMILES | CS(=O)(=O)c1ccc2nc(-c3ccc(Cl)c(Cl)c3)[nH]c2c1 |
| InChI | InChI=1S/C14H10Cl2N2O2S/c1-21(19,20)9-3-5-12-13(7-9)18-14(17-12)8-2-4-10(15)11(16)6-8/h2-7H,1H3,(H,17,18) |
| InChIKey | IIZPTFFJXZEUFP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.22 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |