C15H12Cl2N4 — CID 23085615
N'-[2-(3,4-dichlorophenyl)-3H-benzimidazol-5-yl]ethanimidamide (PubChem CID 23085615) has the molecular formula C15H12Cl2N4 and a molecular weight of 319.20 g/mol. Its IUPAC name is N'-[2-(3,4-dichlorophenyl)-3H-benzimidazol-5-yl]ethanimidamide.
| Compound Name | N'-[2-(3,4-dichlorophenyl)-3H-benzimidazol-5-yl]ethanimidamide |
|---|---|
| PubChem CID | 23085615 |
| Molecular Formula | C15H12Cl2N4 |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | N'-[2-(3,4-dichlorophenyl)-3H-benzimidazol-5-yl]ethanimidamide |
| SMILES | C/C(N)=N\c1ccc2nc(-c3ccc(Cl)c(Cl)c3)[nH]c2c1 |
| InChI | InChI=1S/C15H12Cl2N4/c1-8(18)19-10-3-5-13-14(7-10)21-15(20-13)9-2-4-11(16)12(17)6-9/h2-7H,1H3,(H2,18,19)(H,20,21) |
| InChIKey | OHYWLYUELUXRCY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 67.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|