C15H12N6 — CID 164627119
2-[2-(4-cyanophenyl)-3H-benzimidazol-5-yl]guanidine (PubChem CID 164627119) has the molecular formula C15H12N6 and a molecular weight of 276.30 g/mol. Its IUPAC name is 2-[2-(4-cyanophenyl)-3H-benzimidazol-5-yl]guanidine.
| Compound Name | 2-[2-(4-cyanophenyl)-3H-benzimidazol-5-yl]guanidine |
|---|---|
| PubChem CID | 164627119 |
| Molecular Formula | C15H12N6 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 2-[2-(4-cyanophenyl)-3H-benzimidazol-5-yl]guanidine |
| SMILES | N#Cc1ccc(-c2nc3ccc(N=C(N)N)cc3[nH]2)cc1 |
| InChI | InChI=1S/C15H12N6/c16-8-9-1-3-10(4-2-9)14-20-12-6-5-11(19-15(17)18)7-13(12)21-14/h1-7H,(H,20,21)(H4,17,18,19) |
| InChIKey | SKZAQNGZUYKINS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 116.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|