C19H15N3O — CID 46992207
2-[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]-3H-benzimidazole-5-carbonitrile (PubChem CID 46992207) has the molecular formula C19H15N3O and a molecular weight of 301.35 g/mol. Its IUPAC name is 2-[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]-3H-benzimidazole-5-carbonitrile.
| Compound Name | 2-[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]-3H-benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 46992207 |
| Molecular Formula | C19H15N3O |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 2-[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]-3H-benzimidazole-5-carbonitrile |
| SMILES | CC(C)(O)C#Cc1ccc(-c2nc3ccc(C#N)cc3[nH]2)cc1 |
| InChI | InChI=1S/C19H15N3O/c1-19(2,23)10-9-13-3-6-15(7-4-13)18-21-16-8-5-14(12-20)11-17(16)22-18/h3-8,11,23H,1-2H3,(H,21,22) |
| InChIKey | SXCNILVXHAYFBA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|