C17H13Cl2N3 — CID 68545730
N'-[2-(3,4-dichlorophenyl)quinolin-7-yl]ethanimidamide (PubChem CID 68545730) has the molecular formula C17H13Cl2N3 and a molecular weight of 330.22 g/mol. Its IUPAC name is N'-[2-(3,4-dichlorophenyl)quinolin-7-yl]ethanimidamide.
| Compound Name | N'-[2-(3,4-dichlorophenyl)quinolin-7-yl]ethanimidamide |
|---|---|
| PubChem CID | 68545730 |
| Molecular Formula | C17H13Cl2N3 |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | N'-[2-(3,4-dichlorophenyl)quinolin-7-yl]ethanimidamide |
| SMILES | C/C(N)=N\c1ccc2ccc(-c3ccc(Cl)c(Cl)c3)nc2c1 |
| InChI | InChI=1S/C17H13Cl2N3/c1-10(20)21-13-5-2-11-4-7-16(22-17(11)9-13)12-3-6-14(18)15(19)8-12/h2-9H,1H3,(H2,20,21) |
| InChIKey | NYJQAEXYZFKAAZ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|