C16H11Cl2N — CID 135057486
2-(3,4-dichlorophenyl)-7-methylquinoline (PubChem CID 135057486) has the molecular formula C16H11Cl2N and a molecular weight of 288.18 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-7-methylquinoline.
| Compound Name | 2-(3,4-dichlorophenyl)-7-methylquinoline |
|---|---|
| PubChem CID | 135057486 |
| Molecular Formula | C16H11Cl2N |
| Molecular Weight | 288.18 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-7-methylquinoline |
| SMILES | Cc1ccc2ccc(-c3ccc(Cl)c(Cl)c3)nc2c1 |
| InChI | InChI=1S/C16H11Cl2N/c1-10-2-3-11-5-7-15(19-16(11)8-10)12-4-6-13(17)14(18)9-12/h2-9H,1H3 |
| InChIKey | FNVVHLVYVNBNMK-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.18 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |