C57H45N3O6 — CID 134178902
tris[4-(7-methylquinolin-2-yl)phenyl] cyclohexane-1,3,5-tricarboxylate (PubChem CID 134178902) has the molecular formula C57H45N3O6 and a molecular weight of 868.00 g/mol. Its IUPAC name is tris[4-(7-methylquinolin-2-yl)phenyl] cyclohexane-1,3,5-tricarboxylate.
| Compound Name | tris[4-(7-methylquinolin-2-yl)phenyl] cyclohexane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 134178902 |
| Molecular Formula | C57H45N3O6 |
| Molecular Weight | 868.00 g/mol |
| Exact Mass | 867.33 |
| IUPAC Name | tris[4-(7-methylquinolin-2-yl)phenyl] cyclohexane-1,3,5-tricarboxylate |
| SMILES | Cc1ccc2ccc(-c3ccc(OC(=O)C4CC(C(=O)Oc5ccc(-c6ccc7ccc(C)cc7n6)cc5)CC(C(=O)Oc5ccc(-c6ccc7ccc(C)cc7n6)cc5)C4)cc3)nc2c1 |
| InChI | InChI=1S/C57H45N3O6/c1-34-4-7-40-16-25-49(58-52(40)28-34)37-10-19-46(20-11-37)64-55(61)43-31-44(56(62)65-47-21-12-38(13-22-47)50-26-17-41-8-5-35(2)29-53(41)59-50)33-45(32-43)57(63)66-48-23-14-39(15-24-48)51-27-18-42-9-6-36(3)30-54(42)60-51/h4-30,43-45H,31-33H2,1-3H3 |
| InChIKey | ALSFYGJFZDVDMM-UHFFFAOYSA-N |
| XLogP | 12.41 |
| TPSA | 117.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.00 |
| LogP ≤ 5 | 12.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|