C60H45N3O6 — CID 134178810
tris[6-(4-phenylphenyl)-3-pyridinyl] cyclohexane-1,3,5-tricarboxylate (PubChem CID 134178810) has the molecular formula C60H45N3O6 and a molecular weight of 904.04 g/mol. Its IUPAC name is tris[6-(4-phenylphenyl)-3-pyridinyl] cyclohexane-1,3,5-tricarboxylate.
| Compound Name | tris[6-(4-phenylphenyl)-3-pyridinyl] cyclohexane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 134178810 |
| Molecular Formula | C60H45N3O6 |
| Molecular Weight | 904.04 g/mol |
| Exact Mass | 903.33 |
| IUPAC Name | tris[6-(4-phenylphenyl)-3-pyridinyl] cyclohexane-1,3,5-tricarboxylate |
| SMILES | O=C(Oc1ccc(-c2ccc(-c3ccccc3)cc2)nc1)C1CC(C(=O)Oc2ccc(-c3ccc(-c4ccccc4)cc3)nc2)CC(C(=O)Oc2ccc(-c3ccc(-c4ccccc4)cc3)nc2)C1 |
| InChI | InChI=1S/C60H45N3O6/c64-58(67-52-28-31-55(61-37-52)46-22-16-43(17-23-46)40-10-4-1-5-11-40)49-34-50(59(65)68-53-29-32-56(62-38-53)47-24-18-44(19-25-47)41-12-6-2-7-13-41)36-51(35-49)60(66)69-54-30-33-57(63-39-54)48-26-20-45(21-27-48)42-14-8-3-9-15-42/h1-33,37-39,49-51H,34-36H2 |
| InChIKey | SIXMKDRWCCCOHY-UHFFFAOYSA-N |
| XLogP | 13.02 |
| TPSA | 117.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 904.04 |
| LogP ≤ 5 | 13.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |