C42H27N3O6 — CID 126638838
tris(6-phenyl-3-pyridinyl) benzene-1,3,5-tricarboxylate (PubChem CID 126638838) has the molecular formula C42H27N3O6 and a molecular weight of 669.69 g/mol. Its IUPAC name is tris(6-phenyl-3-pyridinyl) benzene-1,3,5-tricarboxylate.
| Compound Name | tris(6-phenyl-3-pyridinyl) benzene-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 126638838 |
| Molecular Formula | C42H27N3O6 |
| Molecular Weight | 669.69 g/mol |
| Exact Mass | 669.19 |
| IUPAC Name | tris(6-phenyl-3-pyridinyl) benzene-1,3,5-tricarboxylate |
| SMILES | O=C(Oc1ccc(-c2ccccc2)nc1)c1cc(C(=O)Oc2ccc(-c3ccccc3)nc2)cc(C(=O)Oc2ccc(-c3ccccc3)nc2)c1 |
| InChI | InChI=1S/C42H27N3O6/c46-40(49-34-16-19-37(43-25-34)28-10-4-1-5-11-28)31-22-32(41(47)50-35-17-20-38(44-26-35)29-12-6-2-7-13-29)24-33(23-31)42(48)51-36-18-21-39(45-27-36)30-14-8-3-9-15-30/h1-27H |
| InChIKey | HPXLWTIGNGMHMX-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 117.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.69 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |