C11H12Cl2N2 — CID 5355729
(Z)-N'-(3,4-dichlorophenyl)-2-methylbut-2-enimidamide (PubChem CID 5355729) has the molecular formula C11H12Cl2N2 and a molecular weight of 243.14 g/mol. Its IUPAC name is (Z)-N'-(3,4-dichlorophenyl)-2-methylbut-2-enimidamide.
| Compound Name | (Z)-N'-(3,4-dichlorophenyl)-2-methylbut-2-enimidamide |
|---|---|
| PubChem CID | 5355729 |
| Molecular Formula | C11H12Cl2N2 |
| Molecular Weight | 243.14 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | (Z)-N'-(3,4-dichlorophenyl)-2-methylbut-2-enimidamide |
| SMILES | C/C=C(C)\C(N)=N\c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H12Cl2N2/c1-3-7(2)11(14)15-8-4-5-9(12)10(13)6-8/h3-6H,1-2H3,(H2,14,15)/b7-3- |
| InChIKey | CEPZRGMGLKSKKE-CLTKARDFSA-N |
| XLogP | 3.95 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.14 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|