About methyl N'-[N'-(3,4-dichlorophenyl)carbamimidoyl]carbamimidothioate
methyl N'-[N'-(3,4-dichlorophenyl)carbamimidoyl]carbamimidothioate (PubChem CID 15068519) has the molecular formula C9H10Cl2N4S
and a molecular weight of 277.18 g/mol. Its IUPAC name is methyl N'-[N'-(3,4-dichlorophenyl)carbamimidoyl]carbamimidothioate.
Molecular Properties
| Compound Name | methyl N'-[N'-(3,4-dichlorophenyl)carbamimidoyl]carbamimidothioate |
| PubChem CID | 15068519 |
| Molecular Formula | C9H10Cl2N4S |
| Molecular Weight | 277.18 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | methyl N'-[N'-(3,4-dichlorophenyl)carbamimidoyl]carbamimidothioate |
| SMILES | CS/C(N)=N/C(N)=N/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H10Cl2N4S/c1-16-9(13)15-8(12)14-5-2-3-6(10)7(11)4-5/h2-4H,1H3,(H4,12,13,14,15) |
| InChIKey | VYNBACIWVHLVDZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.18 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N'-[N'-(3,4-dichlorophenyl)carbamimidoyl]carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N'-[N'-(3,4-dichlorophenyl)carbamimidoyl]carbamimidothioate?
The IUPAC name of methyl N'-[N'-(3,4-dichlorophenyl)carbamimidoyl]carbamimidothioate (CID 15068519) is methyl N'-[N'-(3,4-dichlorophenyl)carbamimidoyl]carbamimidothioate.
What is the SMILES notation for methyl N'-[N'-(3,4-dichlorophenyl)carbamimidoyl]carbamimidothioate?
The canonical SMILES for methyl N'-[N'-(3,4-dichlorophenyl)carbamimidoyl]carbamimidothioate is CS/C(N)=N/C(N)=N/c1ccc(Cl)c(Cl)c1.
What is the InChIKey of methyl N'-[N'-(3,4-dichlorophenyl)carbamimidoyl]carbamimidothioate?
The InChIKey is VYNBACIWVHLVDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10Cl2N4S/c1-16-9(13)15-8(12)14-5-2-3-6(10)7(11)4-5/h2-4H,1H3,(H4,12,13,14,15).
What are the key properties of methyl N'-[N'-(3,4-dichlorophenyl)carbamimidoyl]carbamimidothioate?
methyl N'-[N'-(3,4-dichlorophenyl)carbamimidoyl]carbamimidothioate has a molecular weight of 277.18 g/mol, XLogP of 2.62, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N'-[N'-(3,4-dichlorophenyl)carbamimidoyl]carbamimidothioate is sourced from PubChem (CID 15068519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).