C11H14Cl2N4 — CID 67556034
(E)-3-amino-N'-(3,4-dichlorophenyl)-3-(dimethylamino)prop-2-enimidamide (PubChem CID 67556034) has the molecular formula C11H14Cl2N4 and a molecular weight of 273.17 g/mol. Its IUPAC name is (E)-3-amino-N'-(3,4-dichlorophenyl)-3-(dimethylamino)prop-2-enimidamide.
| Compound Name | (E)-3-amino-N'-(3,4-dichlorophenyl)-3-(dimethylamino)prop-2-enimidamide |
|---|---|
| PubChem CID | 67556034 |
| Molecular Formula | C11H14Cl2N4 |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | (E)-3-amino-N'-(3,4-dichlorophenyl)-3-(dimethylamino)prop-2-enimidamide |
| SMILES | CN(C)/C(N)=C/C(N)=N/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H14Cl2N4/c1-17(2)11(15)6-10(14)16-7-3-4-8(12)9(13)5-7/h3-6H,15H2,1-2H3,(H2,14,16)/b11-6+ |
| InChIKey | BISNOVBNMMZOLK-IZZDOVSWSA-N |
| XLogP | 2.34 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|