C14H19ClFN3 — CID 146728761
2-(3-chloro-4-fluorophenyl)imino-5,5-dimethylhex-3-ene-1,4-diamine (PubChem CID 146728761) has the molecular formula C14H19ClFN3 and a molecular weight of 283.78 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenyl)imino-5,5-dimethylhex-3-ene-1,4-diamine.
| Compound Name | 2-(3-chloro-4-fluorophenyl)imino-5,5-dimethylhex-3-ene-1,4-diamine |
|---|---|
| PubChem CID | 146728761 |
| Molecular Formula | C14H19ClFN3 |
| Molecular Weight | 283.78 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 2-(3-chloro-4-fluorophenyl)imino-5,5-dimethylhex-3-ene-1,4-diamine |
| SMILES | CC(C)(C)C(N)=C/C(CN)=N/c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H19ClFN3/c1-14(2,3)13(18)7-10(8-17)19-9-4-5-12(16)11(15)6-9/h4-7H,8,17-18H2,1-3H3/b13-7?,19-10- |
| InChIKey | ZKXFVCDXGNKTBU-JCPNNSFWSA-N |
| XLogP | 3.40 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.78 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|