About 5-(5-chloro-3-fluoro-2-pyridinyl)-4-(3,4-difluorophenyl)imino-1,1-difluoropent-2-en-2-amine
5-(5-chloro-3-fluoro-2-pyridinyl)-4-(3,4-difluorophenyl)imino-1,1-difluoropent-2-en-2-amine (PubChem CID 175628777) has the molecular formula C16H11ClF5N3
and a molecular weight of 375.73 g/mol. Its IUPAC name is 5-(5-chloro-3-fluoro-2-pyridinyl)-4-(3,4-difluorophenyl)imino-1,1-difluoropent-2-en-2-amine.
Molecular Properties
| Compound Name | 5-(5-chloro-3-fluoro-2-pyridinyl)-4-(3,4-difluorophenyl)imino-1,1-difluoropent-2-en-2-amine |
| PubChem CID | 175628777 |
| Molecular Formula | C16H11ClF5N3 |
| Molecular Weight | 375.73 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 5-(5-chloro-3-fluoro-2-pyridinyl)-4-(3,4-difluorophenyl)imino-1,1-difluoropent-2-en-2-amine |
| SMILES | NC(=C/C(Cc1ncc(Cl)cc1F)=N\c1ccc(F)c(F)c1)C(F)F |
| InChI | InChI=1S/C16H11ClF5N3/c17-8-3-13(20)15(24-7-8)6-10(5-14(23)16(21)22)25-9-1-2-11(18)12(19)4-9/h1-5,7,16H,6,23H2/b14-5?,25-10+ |
| InChIKey | YUFAGTVLTHNLTH-QREYXXNNSA-N |
| XLogP | 4.58 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.73 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-(5-chloro-3-fluoro-2-pyridinyl)-4-(3,4-difluorophenyl)imino-1,1-difluoropent-2-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-chloro-3-fluoro-2-pyridinyl)-4-(3,4-difluorophenyl)imino-1,1-difluoropent-2-en-2-amine?
The IUPAC name of 5-(5-chloro-3-fluoro-2-pyridinyl)-4-(3,4-difluorophenyl)imino-1,1-difluoropent-2-en-2-amine (CID 175628777) is 5-(5-chloro-3-fluoro-2-pyridinyl)-4-(3,4-difluorophenyl)imino-1,1-difluoropent-2-en-2-amine.
What is the SMILES notation for 5-(5-chloro-3-fluoro-2-pyridinyl)-4-(3,4-difluorophenyl)imino-1,1-difluoropent-2-en-2-amine?
The canonical SMILES for 5-(5-chloro-3-fluoro-2-pyridinyl)-4-(3,4-difluorophenyl)imino-1,1-difluoropent-2-en-2-amine is NC(=C/C(Cc1ncc(Cl)cc1F)=N\c1ccc(F)c(F)c1)C(F)F.
What is the InChIKey of 5-(5-chloro-3-fluoro-2-pyridinyl)-4-(3,4-difluorophenyl)imino-1,1-difluoropent-2-en-2-amine?
The InChIKey is YUFAGTVLTHNLTH-QREYXXNNSA-N. The full InChI is InChI=1S/C16H11ClF5N3/c17-8-3-13(20)15(24-7-8)6-10(5-14(23)16(21)22)25-9-1-2-11(18)12(19)4-9/h1-5,7,16H,6,23H2/b14-5?,25-10+.
What are the key properties of 5-(5-chloro-3-fluoro-2-pyridinyl)-4-(3,4-difluorophenyl)imino-1,1-difluoropent-2-en-2-amine?
5-(5-chloro-3-fluoro-2-pyridinyl)-4-(3,4-difluorophenyl)imino-1,1-difluoropent-2-en-2-amine has a molecular weight of 375.73 g/mol, XLogP of 4.58, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-chloro-3-fluoro-2-pyridinyl)-4-(3,4-difluorophenyl)imino-1,1-difluoropent-2-en-2-amine is sourced from PubChem (CID 175628777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).