C16H11ClF5N3 — CID 175628777
5-(5-chloro-3-fluoro-2-pyridinyl)-4-(3,4-difluorophenyl)imino-1,1-difluoropent-2-en-2-amine (PubChem CID 175628777) has the molecular formula C16H11ClF5N3 and a molecular weight of 375.73 g/mol. Its IUPAC name is 5-(5-chloro-3-fluoro-2-pyridinyl)-4-(3,4-difluorophenyl)imino-1,1-difluoropent-2-en-2-amine.
| Compound Name | 5-(5-chloro-3-fluoro-2-pyridinyl)-4-(3,4-difluorophenyl)imino-1,1-difluoropent-2-en-2-amine |
|---|---|
| PubChem CID | 175628777 |
| Molecular Formula | C16H11ClF5N3 |
| Molecular Weight | 375.73 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 5-(5-chloro-3-fluoro-2-pyridinyl)-4-(3,4-difluorophenyl)imino-1,1-difluoropent-2-en-2-amine |
| SMILES | NC(=C/C(Cc1ncc(Cl)cc1F)=N\c1ccc(F)c(F)c1)C(F)F |
| InChI | InChI=1S/C16H11ClF5N3/c17-8-3-13(20)15(24-7-8)6-10(5-14(23)16(21)22)25-9-1-2-11(18)12(19)4-9/h1-5,7,16H,6,23H2/b14-5?,25-10+ |
| InChIKey | YUFAGTVLTHNLTH-QREYXXNNSA-N |
| XLogP | 4.58 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.73 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|