C13H9Cl2F2NO — CID 82920233
1-(3,5-dichloro-2-pyridinyl)-2-(3,4-difluorophenyl)ethanol (PubChem CID 82920233) has the molecular formula C13H9Cl2F2NO and a molecular weight of 304.12 g/mol. Its IUPAC name is 1-(3,5-dichloro-2-pyridinyl)-2-(3,4-difluorophenyl)ethanol.
| Compound Name | 1-(3,5-dichloro-2-pyridinyl)-2-(3,4-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 82920233 |
| Molecular Formula | C13H9Cl2F2NO |
| Molecular Weight | 304.12 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | 1-(3,5-dichloro-2-pyridinyl)-2-(3,4-difluorophenyl)ethanol |
| SMILES | OC(Cc1ccc(F)c(F)c1)c1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C13H9Cl2F2NO/c14-8-5-9(15)13(18-6-8)12(19)4-7-1-2-10(16)11(17)3-7/h1-3,5-6,12,19H,4H2 |
| InChIKey | LVYBAEUECPJJAS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.12 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |