C13H9BrCl2FNO — CID 79786869
2-(3-bromo-5-fluorophenyl)-1-(3,5-dichloro-2-pyridinyl)ethanol (PubChem CID 79786869) has the molecular formula C13H9BrCl2FNO and a molecular weight of 365.03 g/mol. Its IUPAC name is 2-(3-bromo-5-fluorophenyl)-1-(3,5-dichloro-2-pyridinyl)ethanol.
| Compound Name | 2-(3-bromo-5-fluorophenyl)-1-(3,5-dichloro-2-pyridinyl)ethanol |
|---|---|
| PubChem CID | 79786869 |
| Molecular Formula | C13H9BrCl2FNO |
| Molecular Weight | 365.03 g/mol |
| Exact Mass | 362.92 |
| IUPAC Name | 2-(3-bromo-5-fluorophenyl)-1-(3,5-dichloro-2-pyridinyl)ethanol |
| SMILES | OC(Cc1cc(F)cc(Br)c1)c1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C13H9BrCl2FNO/c14-8-1-7(2-10(17)4-8)3-12(19)13-11(16)5-9(15)6-18-13/h1-2,4-6,12,19H,3H2 |
| InChIKey | IDGVJLIVMVQRKF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.03 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |