C11H14BrClN2 — CID 107617114
N'-(4-bromo-3-chlorophenyl)-2,2-dimethylpropanimidamide (PubChem CID 107617114) has the molecular formula C11H14BrClN2 and a molecular weight of 289.60 g/mol. Its IUPAC name is N'-(4-bromo-3-chlorophenyl)-2,2-dimethylpropanimidamide.
| Compound Name | N'-(4-bromo-3-chlorophenyl)-2,2-dimethylpropanimidamide |
|---|---|
| PubChem CID | 107617114 |
| Molecular Formula | C11H14BrClN2 |
| Molecular Weight | 289.60 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | N'-(4-bromo-3-chlorophenyl)-2,2-dimethylpropanimidamide |
| SMILES | CC(C)(C)/C(N)=N/c1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C11H14BrClN2/c1-11(2,3)10(14)15-7-4-5-8(12)9(13)6-7/h4-6H,1-3H3,(H2,14,15) |
| InChIKey | IJFKXQFSPGIOSG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.60 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|