C11H14F3N3 — CID 82817189
2,2-dimethyl-N'-[6-(trifluoromethyl)-3-pyridinyl]propanimidamide (PubChem CID 82817189) has the molecular formula C11H14F3N3 and a molecular weight of 245.25 g/mol. Its IUPAC name is 2,2-dimethyl-N'-[6-(trifluoromethyl)-3-pyridinyl]propanimidamide.
| Compound Name | 2,2-dimethyl-N'-[6-(trifluoromethyl)-3-pyridinyl]propanimidamide |
|---|---|
| PubChem CID | 82817189 |
| Molecular Formula | C11H14F3N3 |
| Molecular Weight | 245.25 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 2,2-dimethyl-N'-[6-(trifluoromethyl)-3-pyridinyl]propanimidamide |
| SMILES | CC(C)(C)/C(N)=N/c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C11H14F3N3/c1-10(2,3)9(15)17-7-4-5-8(16-6-7)11(12,13)14/h4-6H,1-3H3,(H2,15,17) |
| InChIKey | TZFCLBXCPCDLJR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.25 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|