C14H10BrF3N2O3S — CID 178180304
N-(4-bromo-2-methylsulfonylphenyl)-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 178180304) has the molecular formula C14H10BrF3N2O3S and a molecular weight of 423.21 g/mol. Its IUPAC name is N-(4-bromo-2-methylsulfonylphenyl)-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-(4-bromo-2-methylsulfonylphenyl)-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 178180304 |
| Molecular Formula | C14H10BrF3N2O3S |
| Molecular Weight | 423.21 g/mol |
| Exact Mass | 421.95 |
| IUPAC Name | N-(4-bromo-2-methylsulfonylphenyl)-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | CS(=O)(=O)c1cc(Br)ccc1NC(=O)c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C14H10BrF3N2O3S/c1-24(22,23)11-6-9(15)3-4-10(11)20-13(21)8-2-5-12(19-7-8)14(16,17)18/h2-7H,1H3,(H,20,21) |
| InChIKey | HAWONOLZAJRLID-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.21 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |