C19H20F3N3O5 — CID 134026408
N-(2-nitro-4,5-dipropoxyphenyl)-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 134026408) has the molecular formula C19H20F3N3O5 and a molecular weight of 427.38 g/mol. Its IUPAC name is N-(2-nitro-4,5-dipropoxyphenyl)-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-(2-nitro-4,5-dipropoxyphenyl)-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 134026408 |
| Molecular Formula | C19H20F3N3O5 |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | N-(2-nitro-4,5-dipropoxyphenyl)-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | CCCOc1cc(NC(=O)c2ccc(C(F)(F)F)nc2)c([N+](=O)[O-])cc1OCCC |
| InChI | InChI=1S/C19H20F3N3O5/c1-3-7-29-15-9-13(14(25(27)28)10-16(15)30-8-4-2)24-18(26)12-5-6-17(23-11-12)19(20,21)22/h5-6,9-11H,3-4,7-8H2,1-2H3,(H,24,26) |
| InChIKey | SASNQEWAXLYHAF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|