C20H18F3N3O5S — CID 112818690
N-(4,5-diethoxy-2-nitrophenyl)-3-methyl-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 112818690) has the molecular formula C20H18F3N3O5S and a molecular weight of 469.44 g/mol. Its IUPAC name is N-(4,5-diethoxy-2-nitrophenyl)-3-methyl-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | N-(4,5-diethoxy-2-nitrophenyl)-3-methyl-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 112818690 |
| Molecular Formula | C20H18F3N3O5S |
| Molecular Weight | 469.44 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | N-(4,5-diethoxy-2-nitrophenyl)-3-methyl-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | CCOc1cc(NC(=O)c2sc3nc(C(F)(F)F)ccc3c2C)c([N+](=O)[O-])cc1OCC |
| InChI | InChI=1S/C20H18F3N3O5S/c1-4-30-14-8-12(13(26(28)29)9-15(14)31-5-2)24-18(27)17-10(3)11-6-7-16(20(21,22)23)25-19(11)32-17/h6-9H,4-5H2,1-3H3,(H,24,27) |
| InChIKey | YZRVINRPSAESIO-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.44 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|