C17H21N3O5S — CID 60531309
4-methyl-N-(2-nitro-4,5-dipropoxyphenyl)-1,3-thiazole-5-carboxamide (PubChem CID 60531309) has the molecular formula C17H21N3O5S and a molecular weight of 379.44 g/mol. Its IUPAC name is 4-methyl-N-(2-nitro-4,5-dipropoxyphenyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-N-(2-nitro-4,5-dipropoxyphenyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 60531309 |
| Molecular Formula | C17H21N3O5S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 4-methyl-N-(2-nitro-4,5-dipropoxyphenyl)-1,3-thiazole-5-carboxamide |
| SMILES | CCCOc1cc(NC(=O)c2scnc2C)c([N+](=O)[O-])cc1OCCC |
| InChI | InChI=1S/C17H21N3O5S/c1-4-6-24-14-8-12(19-17(21)16-11(3)18-10-26-16)13(20(22)23)9-15(14)25-7-5-2/h8-10H,4-7H2,1-3H3,(H,19,21) |
| InChIKey | YGAALHYXWQRPCI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|