C19H25N3O7S2 — CID 55461123
2-[methyl(thiophen-2-ylsulfonyl)amino]-N-(2-nitro-4,5-dipropoxyphenyl)acetamide (PubChem CID 55461123) has the molecular formula C19H25N3O7S2 and a molecular weight of 471.56 g/mol. Its IUPAC name is 2-[methyl(thiophen-2-ylsulfonyl)amino]-N-(2-nitro-4,5-dipropoxyphenyl)acetamide.
| Compound Name | 2-[methyl(thiophen-2-ylsulfonyl)amino]-N-(2-nitro-4,5-dipropoxyphenyl)acetamide |
|---|---|
| PubChem CID | 55461123 |
| Molecular Formula | C19H25N3O7S2 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | 2-[methyl(thiophen-2-ylsulfonyl)amino]-N-(2-nitro-4,5-dipropoxyphenyl)acetamide |
| SMILES | CCCOc1cc(NC(=O)CN(C)S(=O)(=O)c2cccs2)c([N+](=O)[O-])cc1OCCC |
| InChI | InChI=1S/C19H25N3O7S2/c1-4-8-28-16-11-14(15(22(24)25)12-17(16)29-9-5-2)20-18(23)13-21(3)31(26,27)19-7-6-10-30-19/h6-7,10-12H,4-5,8-9,13H2,1-3H3,(H,20,23) |
| InChIKey | QUPACLZHWYRYGD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|