C17H22N2O5S2 — CID 4820945
N-(3,4-diethoxyphenyl)-2-[methyl(thiophen-2-ylsulfonyl)amino]acetamide (PubChem CID 4820945) has the molecular formula C17H22N2O5S2 and a molecular weight of 398.51 g/mol. Its IUPAC name is N-(3,4-diethoxyphenyl)-2-[methyl(thiophen-2-ylsulfonyl)amino]acetamide.
| Compound Name | N-(3,4-diethoxyphenyl)-2-[methyl(thiophen-2-ylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 4820945 |
| Molecular Formula | C17H22N2O5S2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | N-(3,4-diethoxyphenyl)-2-[methyl(thiophen-2-ylsulfonyl)amino]acetamide |
| SMILES | CCOc1ccc(NC(=O)CN(C)S(=O)(=O)c2cccs2)cc1OCC |
| InChI | InChI=1S/C17H22N2O5S2/c1-4-23-14-9-8-13(11-15(14)24-5-2)18-16(20)12-19(3)26(21,22)17-7-6-10-25-17/h6-11H,4-5,12H2,1-3H3,(H,18,20) |
| InChIKey | LTAHMCJKFSUJIL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |