C20H22N4O5 — CID 56506850
N-(2-nitro-4,5-dipropoxyphenyl)imidazo[1,2-a]pyridine-6-carboxamide (PubChem CID 56506850) has the molecular formula C20H22N4O5 and a molecular weight of 398.42 g/mol. Its IUPAC name is N-(2-nitro-4,5-dipropoxyphenyl)imidazo[1,2-a]pyridine-6-carboxamide.
| Compound Name | N-(2-nitro-4,5-dipropoxyphenyl)imidazo[1,2-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 56506850 |
| Molecular Formula | C20H22N4O5 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | N-(2-nitro-4,5-dipropoxyphenyl)imidazo[1,2-a]pyridine-6-carboxamide |
| SMILES | CCCOc1cc(NC(=O)c2ccc3nccn3c2)c([N+](=O)[O-])cc1OCCC |
| InChI | InChI=1S/C20H22N4O5/c1-3-9-28-17-11-15(16(24(26)27)12-18(17)29-10-4-2)22-20(25)14-5-6-19-21-7-8-23(19)13-14/h5-8,11-13H,3-4,9-10H2,1-2H3,(H,22,25) |
| InChIKey | UAODWDJBEVPPFB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|