C22H27N3O8S — CID 55607639
2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]-N-(2-nitro-4,5-dipropoxyphenyl)acetamide (PubChem CID 55607639) has the molecular formula C22H27N3O8S and a molecular weight of 493.54 g/mol. Its IUPAC name is 2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]-N-(2-nitro-4,5-dipropoxyphenyl)acetamide.
| Compound Name | 2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]-N-(2-nitro-4,5-dipropoxyphenyl)acetamide |
|---|---|
| PubChem CID | 55607639 |
| Molecular Formula | C22H27N3O8S |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | 2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]-N-(2-nitro-4,5-dipropoxyphenyl)acetamide |
| SMILES | CCCOc1cc(NC(=O)CSCc2ccc(OC)c([N+](=O)[O-])c2)c([N+](=O)[O-])cc1OCCC |
| InChI | InChI=1S/C22H27N3O8S/c1-4-8-32-20-11-16(17(24(27)28)12-21(20)33-9-5-2)23-22(26)14-34-13-15-6-7-19(31-3)18(10-15)25(29)30/h6-7,10-12H,4-5,8-9,13-14H2,1-3H3,(H,23,26) |
| InChIKey | BWJDZOYQIXLZHU-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 143.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|