C20H22N4O6S — CID 56573342
N-(3-amino-3-oxopropyl)-2-[[2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetyl]amino]benzamide (PubChem CID 56573342) has the molecular formula C20H22N4O6S and a molecular weight of 446.49 g/mol. Its IUPAC name is N-(3-amino-3-oxopropyl)-2-[[2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetyl]amino]benzamide.
| Compound Name | N-(3-amino-3-oxopropyl)-2-[[2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 56573342 |
| Molecular Formula | C20H22N4O6S |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | N-(3-amino-3-oxopropyl)-2-[[2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetyl]amino]benzamide |
| SMILES | COc1ccc(CSCC(=O)Nc2ccccc2C(=O)NCCC(N)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H22N4O6S/c1-30-17-7-6-13(10-16(17)24(28)29)11-31-12-19(26)23-15-5-3-2-4-14(15)20(27)22-9-8-18(21)25/h2-7,10H,8-9,11-12H2,1H3,(H2,21,25)(H,22,27)(H,23,26) |
| InChIKey | IVJRIORPWJMRLZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 153.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|