C23H24N4O5S — CID 55616765
N'-[2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetyl]-2,5-dimethyl-1-phenylpyrrole-3-carbohydrazide (PubChem CID 55616765) has the molecular formula C23H24N4O5S and a molecular weight of 468.54 g/mol. Its IUPAC name is N'-[2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetyl]-2,5-dimethyl-1-phenylpyrrole-3-carbohydrazide.
| Compound Name | N'-[2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetyl]-2,5-dimethyl-1-phenylpyrrole-3-carbohydrazide |
|---|---|
| PubChem CID | 55616765 |
| Molecular Formula | C23H24N4O5S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | N'-[2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetyl]-2,5-dimethyl-1-phenylpyrrole-3-carbohydrazide |
| SMILES | COc1ccc(CSCC(=O)NNC(=O)c2cc(C)n(-c3ccccc3)c2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H24N4O5S/c1-15-11-19(16(2)26(15)18-7-5-4-6-8-18)23(29)25-24-22(28)14-33-13-17-9-10-21(32-3)20(12-17)27(30)31/h4-12H,13-14H2,1-3H3,(H,24,28)(H,25,29) |
| InChIKey | CAAPQZCJZBOMAY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 115.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|