C18H19ClN2O6S — CID 46422627
N-(4-chloro-2,5-dimethoxyphenyl)-2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetamide (PubChem CID 46422627) has the molecular formula C18H19ClN2O6S and a molecular weight of 426.88 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 46422627 |
| Molecular Formula | C18H19ClN2O6S |
| Molecular Weight | 426.88 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetamide |
| SMILES | COc1cc(NC(=O)CSCc2ccc(OC)c([N+](=O)[O-])c2)c(OC)cc1Cl |
| InChI | InChI=1S/C18H19ClN2O6S/c1-25-15-5-4-11(6-14(15)21(23)24)9-28-10-18(22)20-13-8-16(26-2)12(19)7-17(13)27-3/h4-8H,9-10H2,1-3H3,(H,20,22) |
| InChIKey | KPGNWKZXCOSBKQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.88 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|