C17H14ClN3O4S2 — CID 46686369
N-(6-chloro-1,3-benzothiazol-2-yl)-2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetamide (PubChem CID 46686369) has the molecular formula C17H14ClN3O4S2 and a molecular weight of 423.90 g/mol. Its IUPAC name is N-(6-chloro-1,3-benzothiazol-2-yl)-2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetamide.
| Compound Name | N-(6-chloro-1,3-benzothiazol-2-yl)-2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 46686369 |
| Molecular Formula | C17H14ClN3O4S2 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.01 |
| IUPAC Name | N-(6-chloro-1,3-benzothiazol-2-yl)-2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetamide |
| SMILES | COc1ccc(CSCC(=O)Nc2nc3ccc(Cl)cc3s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14ClN3O4S2/c1-25-14-5-2-10(6-13(14)21(23)24)8-26-9-16(22)20-17-19-12-4-3-11(18)7-15(12)27-17/h2-7H,8-9H2,1H3,(H,19,20,22) |
| InChIKey | LFZHNEWTKCNSFB-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|