C19H18N4O5S2 — CID 56572354
N-(6-acetamido-1,3-benzothiazol-2-yl)-2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetamide (PubChem CID 56572354) has the molecular formula C19H18N4O5S2 and a molecular weight of 446.51 g/mol. Its IUPAC name is N-(6-acetamido-1,3-benzothiazol-2-yl)-2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetamide.
| Compound Name | N-(6-acetamido-1,3-benzothiazol-2-yl)-2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 56572354 |
| Molecular Formula | C19H18N4O5S2 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | N-(6-acetamido-1,3-benzothiazol-2-yl)-2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetamide |
| SMILES | COc1ccc(CSCC(=O)Nc2nc3ccc(NC(C)=O)cc3s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H18N4O5S2/c1-11(24)20-13-4-5-14-17(8-13)30-19(21-14)22-18(25)10-29-9-12-3-6-16(28-2)15(7-12)23(26)27/h3-8H,9-10H2,1-2H3,(H,20,24)(H,21,22,25) |
| InChIKey | PGGUXBGZRMGMIR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|