C13H15ClN2OS2 — CID 112794492
2-tert-butylsulfanyl-N-(6-chloro-1,3-benzothiazol-2-yl)acetamide (PubChem CID 112794492) has the molecular formula C13H15ClN2OS2 and a molecular weight of 314.86 g/mol. Its IUPAC name is 2-tert-butylsulfanyl-N-(6-chloro-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-tert-butylsulfanyl-N-(6-chloro-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 112794492 |
| Molecular Formula | C13H15ClN2OS2 |
| Molecular Weight | 314.86 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 2-tert-butylsulfanyl-N-(6-chloro-1,3-benzothiazol-2-yl)acetamide |
| SMILES | CC(C)(C)SCC(=O)Nc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C13H15ClN2OS2/c1-13(2,3)18-7-11(17)16-12-15-9-5-4-8(14)6-10(9)19-12/h4-6H,7H2,1-3H3,(H,15,16,17) |
| InChIKey | FVWBNORNEVSHLI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.86 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |