C17H13ClN2O2S — CID 71454867
N-(6-chloro-1,3-benzothiazol-2-yl)-4-oxo-4-phenylbutanamide (PubChem CID 71454867) has the molecular formula C17H13ClN2O2S and a molecular weight of 344.82 g/mol. Its IUPAC name is N-(6-chloro-1,3-benzothiazol-2-yl)-4-oxo-4-phenylbutanamide.
| Compound Name | N-(6-chloro-1,3-benzothiazol-2-yl)-4-oxo-4-phenylbutanamide |
|---|---|
| PubChem CID | 71454867 |
| Molecular Formula | C17H13ClN2O2S |
| Molecular Weight | 344.82 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | N-(6-chloro-1,3-benzothiazol-2-yl)-4-oxo-4-phenylbutanamide |
| SMILES | O=C(CCC(=O)c1ccccc1)Nc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C17H13ClN2O2S/c18-12-6-7-13-15(10-12)23-17(19-13)20-16(22)9-8-14(21)11-4-2-1-3-5-11/h1-7,10H,8-9H2,(H,19,20,22) |
| InChIKey | WMIZXSCOZZFBNI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.82 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |