C15H11ClN2O3S2 — CID 7544410
2-(benzenesulfonyl)-N-(6-chloro-1,3-benzothiazol-2-yl)acetamide (PubChem CID 7544410) has the molecular formula C15H11ClN2O3S2 and a molecular weight of 366.85 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-N-(6-chloro-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-(benzenesulfonyl)-N-(6-chloro-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 7544410 |
| Molecular Formula | C15H11ClN2O3S2 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 365.99 |
| IUPAC Name | 2-(benzenesulfonyl)-N-(6-chloro-1,3-benzothiazol-2-yl)acetamide |
| SMILES | O=C(CS(=O)(=O)c1ccccc1)Nc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C15H11ClN2O3S2/c16-10-6-7-12-13(8-10)22-15(17-12)18-14(19)9-23(20,21)11-4-2-1-3-5-11/h1-8H,9H2,(H,17,18,19) |
| InChIKey | WWSLMDBIJQSUBS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |